C11H13F2N5 — CID 113328734
N-[[3-(difluoromethyl)phenyl]methyl]-1-(2H-tetrazol-5-yl)ethanamine (PubChem CID 113328734) has the molecular formula C11H13F2N5 and a molecular weight of 253.26 g/mol. Its IUPAC name is N-[[3-(difluoromethyl)phenyl]methyl]-1-(2H-tetrazol-5-yl)ethanamine.
| Compound Name | N-[[3-(difluoromethyl)phenyl]methyl]-1-(2H-tetrazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 113328734 |
| Molecular Formula | C11H13F2N5 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | N-[[3-(difluoromethyl)phenyl]methyl]-1-(2H-tetrazol-5-yl)ethanamine |
| SMILES | CC(NCc1cccc(C(F)F)c1)c1nn[nH]n1 |
| InChI | InChI=1S/C11H13F2N5/c1-7(11-15-17-18-16-11)14-6-8-3-2-4-9(5-8)10(12)13/h2-5,7,10,14H,6H2,1H3,(H,15,16,17,18) |
| InChIKey | IDOARQWVBXHZIL-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |