C16H20F2N2O — CID 83246226
5-(3,4-difluorophenyl)-6-pentyl-4,6-diazaspiro[2.4]heptan-7-one (PubChem CID 83246226) has the molecular formula C16H20F2N2O and a molecular weight of 294.35 g/mol. Its IUPAC name is 5-(3,4-difluorophenyl)-6-pentyl-4,6-diazaspiro[2.4]heptan-7-one.
| Compound Name | 5-(3,4-difluorophenyl)-6-pentyl-4,6-diazaspiro[2.4]heptan-7-one |
|---|---|
| PubChem CID | 83246226 |
| Molecular Formula | C16H20F2N2O |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 5-(3,4-difluorophenyl)-6-pentyl-4,6-diazaspiro[2.4]heptan-7-one |
| SMILES | CCCCCN1C(=O)C2(CC2)NC1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H20F2N2O/c1-2-3-4-9-20-14(19-16(7-8-16)15(20)21)11-5-6-12(17)13(18)10-11/h5-6,10,14,19H,2-4,7-9H2,1H3 |
| InChIKey | KTNLOIGMVKOUMM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|