C16H20N2OS2 — CID 83267709
3-[(4-methylthiophen-3-yl)methyl]-5-propan-2-yl-2-thiophen-3-ylimidazolidin-4-one (PubChem CID 83267709) has the molecular formula C16H20N2OS2 and a molecular weight of 320.48 g/mol. Its IUPAC name is 3-[(4-methylthiophen-3-yl)methyl]-5-propan-2-yl-2-thiophen-3-ylimidazolidin-4-one.
| Compound Name | 3-[(4-methylthiophen-3-yl)methyl]-5-propan-2-yl-2-thiophen-3-ylimidazolidin-4-one |
|---|---|
| PubChem CID | 83267709 |
| Molecular Formula | C16H20N2OS2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 3-[(4-methylthiophen-3-yl)methyl]-5-propan-2-yl-2-thiophen-3-ylimidazolidin-4-one |
| SMILES | Cc1cscc1CN1C(=O)C(C(C)C)NC1c1ccsc1 |
| InChI | InChI=1S/C16H20N2OS2/c1-10(2)14-16(19)18(6-13-9-21-7-11(13)3)15(17-14)12-4-5-20-8-12/h4-5,7-10,14-15,17H,6H2,1-3H3 |
| InChIKey | UGGLCCFTAGPSDG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |