C16H19FN4 — CID 83269671
2-[4-(2-fluorophenyl)piperazin-1-yl]-5-methylpyridin-4-amine (PubChem CID 83269671) has the molecular formula C16H19FN4 and a molecular weight of 286.35 g/mol. Its IUPAC name is 2-[4-(2-fluorophenyl)piperazin-1-yl]-5-methylpyridin-4-amine.
| Compound Name | 2-[4-(2-fluorophenyl)piperazin-1-yl]-5-methylpyridin-4-amine |
|---|---|
| PubChem CID | 83269671 |
| Molecular Formula | C16H19FN4 |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | 2-[4-(2-fluorophenyl)piperazin-1-yl]-5-methylpyridin-4-amine |
| SMILES | Cc1cnc(N2CCN(c3ccccc3F)CC2)cc1N |
| InChI | InChI=1S/C16H19FN4/c1-12-11-19-16(10-14(12)18)21-8-6-20(7-9-21)15-5-3-2-4-13(15)17/h2-5,10-11H,6-9H2,1H3,(H2,18,19) |
| InChIKey | MXPYYYYRDMGCGU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |