C24H24N4O3S — CID 83277241
2-(furan-2-yl)-6-methyl-4-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]quinazoline (PubChem CID 83277241) has the molecular formula C24H24N4O3S and a molecular weight of 448.55 g/mol. Its IUPAC name is 2-(furan-2-yl)-6-methyl-4-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]quinazoline.
| Compound Name | 2-(furan-2-yl)-6-methyl-4-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]quinazoline |
|---|---|
| PubChem CID | 83277241 |
| Molecular Formula | C24H24N4O3S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 2-(furan-2-yl)-6-methyl-4-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]quinazoline |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(c3nc(-c4ccco4)nc4ccc(C)cc34)CC2)cc1 |
| InChI | InChI=1S/C24H24N4O3S/c1-17-5-8-19(9-6-17)32(29,30)28-13-11-27(12-14-28)24-20-16-18(2)7-10-21(20)25-23(26-24)22-4-3-15-31-22/h3-10,15-16H,11-14H2,1-2H3 |
| InChIKey | JCKMHKBUXUSJBB-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 79.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |