C25H28N6O3S — CID 83282198
(4-ethylpiperazin-1-yl)-[2-[[5-(4-nitrophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]phenyl]methanone (PubChem CID 83282198) has the molecular formula C25H28N6O3S and a molecular weight of 492.61 g/mol. Its IUPAC name is (4-ethylpiperazin-1-yl)-[2-[[5-(4-nitrophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]phenyl]methanone.
| Compound Name | (4-ethylpiperazin-1-yl)-[2-[[5-(4-nitrophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]phenyl]methanone |
|---|---|
| PubChem CID | 83282198 |
| Molecular Formula | C25H28N6O3S |
| Molecular Weight | 492.61 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | (4-ethylpiperazin-1-yl)-[2-[[5-(4-nitrophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]phenyl]methanone |
| SMILES | C=CCn1c(SCc2ccccc2C(=O)N2CCN(CC)CC2)nnc1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H28N6O3S/c1-3-13-30-23(19-9-11-21(12-10-19)31(33)34)26-27-25(30)35-18-20-7-5-6-8-22(20)24(32)29-16-14-28(4-2)15-17-29/h3,5-12H,1,4,13-18H2,2H3 |
| InChIKey | NWZWNIIZMGVFJE-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 97.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.61 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|