C23H25N5O5S — CID 83284322
[2-[[4-(2-methoxyethyl)-5-(4-nitrophenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]phenyl]-morpholin-4-ylmethanone (PubChem CID 83284322) has the molecular formula C23H25N5O5S and a molecular weight of 483.55 g/mol. Its IUPAC name is [2-[[4-(2-methoxyethyl)-5-(4-nitrophenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]phenyl]-morpholin-4-ylmethanone.
| Compound Name | [2-[[4-(2-methoxyethyl)-5-(4-nitrophenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]phenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 83284322 |
| Molecular Formula | C23H25N5O5S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | [2-[[4-(2-methoxyethyl)-5-(4-nitrophenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]phenyl]-morpholin-4-ylmethanone |
| SMILES | COCCn1c(SCc2ccccc2C(=O)N2CCOCC2)nnc1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H25N5O5S/c1-32-13-12-27-21(17-6-8-19(9-7-17)28(30)31)24-25-23(27)34-16-18-4-2-3-5-20(18)22(29)26-10-14-33-15-11-26/h2-9H,10-16H2,1H3 |
| InChIKey | ZAOHUEPAEFCGFX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 112.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|