C18H16Cl2N2O2 — CID 83284948
3-(3,4-dichlorophenyl)-3-(5-methoxy-1H-indol-3-yl)propanamide (PubChem CID 83284948) has the molecular formula C18H16Cl2N2O2 and a molecular weight of 363.24 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-3-(5-methoxy-1H-indol-3-yl)propanamide.
| Compound Name | 3-(3,4-dichlorophenyl)-3-(5-methoxy-1H-indol-3-yl)propanamide |
|---|---|
| PubChem CID | 83284948 |
| Molecular Formula | C18H16Cl2N2O2 |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-3-(5-methoxy-1H-indol-3-yl)propanamide |
| SMILES | COc1ccc2[nH]cc(C(CC(N)=O)c3ccc(Cl)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C18H16Cl2N2O2/c1-24-11-3-5-17-13(7-11)14(9-22-17)12(8-18(21)23)10-2-4-15(19)16(20)6-10/h2-7,9,12,22H,8H2,1H3,(H2,21,23) |
| InChIKey | AIFSUHNIUKAUHO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |