C16H22NO5P — CID 102085715
1-dimethoxyphosphoryl-4-(5-methoxy-1H-indol-3-yl)pentan-2-one (PubChem CID 102085715) has the molecular formula C16H22NO5P and a molecular weight of 339.33 g/mol. Its IUPAC name is 1-dimethoxyphosphoryl-4-(5-methoxy-1H-indol-3-yl)pentan-2-one.
| Compound Name | 1-dimethoxyphosphoryl-4-(5-methoxy-1H-indol-3-yl)pentan-2-one |
|---|---|
| PubChem CID | 102085715 |
| Molecular Formula | C16H22NO5P |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 1-dimethoxyphosphoryl-4-(5-methoxy-1H-indol-3-yl)pentan-2-one |
| SMILES | COc1ccc2[nH]cc(C(C)CC(=O)CP(=O)(OC)OC)c2c1 |
| InChI | InChI=1S/C16H22NO5P/c1-11(7-12(18)10-23(19,21-3)22-4)15-9-17-16-6-5-13(20-2)8-14(15)16/h5-6,8-9,11,17H,7,10H2,1-4H3 |
| InChIKey | LPEHXOCCTFFKLY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 77.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|