C10H15FN2 — CID 83383940
4-(1-aminoethyl)-3-fluoro-N,N-dimethylaniline (PubChem CID 83383940) has the molecular formula C10H15FN2 and a molecular weight of 182.24 g/mol. Its IUPAC name is 4-(1-aminoethyl)-3-fluoro-N,N-dimethylaniline.
| Compound Name | 4-(1-aminoethyl)-3-fluoro-N,N-dimethylaniline |
|---|---|
| PubChem CID | 83383940 |
| Molecular Formula | C10H15FN2 |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 4-(1-aminoethyl)-3-fluoro-N,N-dimethylaniline |
| SMILES | CC(N)c1ccc(N(C)C)cc1F |
| InChI | InChI=1S/C10H15FN2/c1-7(12)9-5-4-8(13(2)3)6-10(9)11/h4-7H,12H2,1-3H3 |
| InChIKey | AGUNSZSJXBHPTA-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |