About 2-(4,5-dimethyl-1,3-oxazol-2-yl)-2-hydroxypropanoic acid
2-(4,5-dimethyl-1,3-oxazol-2-yl)-2-hydroxypropanoic acid (PubChem CID 83391697) has the molecular formula C8H11NO4
and a molecular weight of 185.18 g/mol. Its IUPAC name is 2-(4,5-dimethyl-1,3-oxazol-2-yl)-2-hydroxypropanoic acid.
Analyze 2-(4,5-dimethyl-1,3-oxazol-2-yl)-2-hydroxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dimethyl-1,3-oxazol-2-yl)-2-hydroxypropanoic acid?
The IUPAC name of 2-(4,5-dimethyl-1,3-oxazol-2-yl)-2-hydroxypropanoic acid (CID 83391697) is 2-(4,5-dimethyl-1,3-oxazol-2-yl)-2-hydroxypropanoic acid.
What is the SMILES notation for 2-(4,5-dimethyl-1,3-oxazol-2-yl)-2-hydroxypropanoic acid?
The canonical SMILES for 2-(4,5-dimethyl-1,3-oxazol-2-yl)-2-hydroxypropanoic acid is Cc1nc(C(C)(O)C(=O)O)oc1C.
What is the InChIKey of 2-(4,5-dimethyl-1,3-oxazol-2-yl)-2-hydroxypropanoic acid?
The InChIKey is ZJXMWKHJOIHJJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO4/c1-4-5(2)13-6(9-4)8(3,12)7(10)11/h12H,1-3H3,(H,10,11).
What are the key properties of 2-(4,5-dimethyl-1,3-oxazol-2-yl)-2-hydroxypropanoic acid?
2-(4,5-dimethyl-1,3-oxazol-2-yl)-2-hydroxypropanoic acid has a molecular weight of 185.18 g/mol, XLogP of 0.58, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dimethyl-1,3-oxazol-2-yl)-2-hydroxypropanoic acid is sourced from PubChem (CID 83391697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).