C12H11F6N — CID 83412581
[1-[3,5-bis(trifluoromethyl)phenyl]cyclopropyl]methanamine (PubChem CID 83412581) has the molecular formula C12H11F6N and a molecular weight of 283.22 g/mol. Its IUPAC name is [1-[3,5-bis(trifluoromethyl)phenyl]cyclopropyl]methanamine.
| Compound Name | [1-[3,5-bis(trifluoromethyl)phenyl]cyclopropyl]methanamine |
|---|---|
| PubChem CID | 83412581 |
| Molecular Formula | C12H11F6N |
| Molecular Weight | 283.22 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | [1-[3,5-bis(trifluoromethyl)phenyl]cyclopropyl]methanamine |
| SMILES | NCC1(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C12H11F6N/c13-11(14,15)8-3-7(10(6-19)1-2-10)4-9(5-8)12(16,17)18/h3-5H,1-2,6,19H2 |
| InChIKey | KGXIEAXGQARWPP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.22 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |