C10H17N3O — CID 83484644
1-(4-methyl-1,3-oxazol-2-yl)azepan-4-amine (PubChem CID 83484644) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is 1-(4-methyl-1,3-oxazol-2-yl)azepan-4-amine.
| Compound Name | 1-(4-methyl-1,3-oxazol-2-yl)azepan-4-amine |
|---|---|
| PubChem CID | 83484644 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 1-(4-methyl-1,3-oxazol-2-yl)azepan-4-amine |
| SMILES | Cc1coc(N2CCCC(N)CC2)n1 |
| InChI | InChI=1S/C10H17N3O/c1-8-7-14-10(12-8)13-5-2-3-9(11)4-6-13/h7,9H,2-6,11H2,1H3 |
| InChIKey | VZNYTPXOXWFHPB-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |