C10H17N3O — CID 83618708
[3-(azepan-1-yl)-1,2-oxazol-4-yl]methanamine (PubChem CID 83618708) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is [3-(azepan-1-yl)-1,2-oxazol-4-yl]methanamine.
| Compound Name | [3-(azepan-1-yl)-1,2-oxazol-4-yl]methanamine |
|---|---|
| PubChem CID | 83618708 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | [3-(azepan-1-yl)-1,2-oxazol-4-yl]methanamine |
| SMILES | NCc1conc1N1CCCCCC1 |
| InChI | InChI=1S/C10H17N3O/c11-7-9-8-14-12-10(9)13-5-3-1-2-4-6-13/h8H,1-7,11H2 |
| InChIKey | GLNWQWDXLBCLSZ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |