C15H16N8 — CID 836333
4,6-dihydrazinyl-N,N-diphenyl-1,3,5-triazin-2-amine (PubChem CID 836333) has the molecular formula C15H16N8 and a molecular weight of 308.35 g/mol. Its IUPAC name is 4,6-dihydrazinyl-N,N-diphenyl-1,3,5-triazin-2-amine.
| Compound Name | 4,6-dihydrazinyl-N,N-diphenyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 836333 |
| Molecular Formula | C15H16N8 |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 4,6-dihydrazinyl-N,N-diphenyl-1,3,5-triazin-2-amine |
| SMILES | NNc1nc(NN)nc(N(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C15H16N8/c16-21-13-18-14(22-17)20-15(19-13)23(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H,16-17H2,(H2,18,19,20,21,22) |
| InChIKey | VOIWUFJRFZOGPU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 118.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|