6-methyl-1,2,4-triazine-5-carboxylic acid

C5H5N3O2 — CID 83635324

IUPAC6-methyl-1,2,4-triazine-5-carboxylic acid
SMILESCc1nncnc1C(=O)O
InChIInChI=1S/C5H5N3O2/c1-3-4(5(9)10)6-2-7-8-3/h2H,1H3,(H,9,10)
InChIKeyPZAFAEAVHLVVDR-UHFFFAOYSA-N
MW139.11 g/mol
LogP-0.12
Rot. Bonds1

About 6-methyl-1,2,4-triazine-5-carboxylic acid

6-methyl-1,2,4-triazine-5-carboxylic acid (PubChem CID 83635324) has the molecular formula C5H5N3O2 and a molecular weight of 139.11 g/mol. Its IUPAC name is 6-methyl-1,2,4-triazine-5-carboxylic acid.

Molecular Properties

Compound Name6-methyl-1,2,4-triazine-5-carboxylic acid
PubChem CID83635324
Molecular FormulaC5H5N3O2
Molecular Weight139.11 g/mol
Exact Mass139.04
IUPAC Name6-methyl-1,2,4-triazine-5-carboxylic acid
SMILESCc1nncnc1C(=O)O
InChIInChI=1S/C5H5N3O2/c1-3-4(5(9)10)6-2-7-8-3/h2H,1H3,(H,9,10)
InChIKeyPZAFAEAVHLVVDR-UHFFFAOYSA-N
XLogP-0.12
TPSA75.97 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500139.11
LogP ≤ 5-0.12
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 6-methyl-1,2,4-triazine-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-methyl-1,2,4-triazine-5-carboxylic acid?
The IUPAC name of 6-methyl-1,2,4-triazine-5-carboxylic acid (CID 83635324) is 6-methyl-1,2,4-triazine-5-carboxylic acid.
What is the SMILES notation for 6-methyl-1,2,4-triazine-5-carboxylic acid?
The canonical SMILES for 6-methyl-1,2,4-triazine-5-carboxylic acid is Cc1nncnc1C(=O)O.
What is the InChIKey of 6-methyl-1,2,4-triazine-5-carboxylic acid?
The InChIKey is PZAFAEAVHLVVDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N3O2/c1-3-4(5(9)10)6-2-7-8-3/h2H,1H3,(H,9,10).
What are the key properties of 6-methyl-1,2,4-triazine-5-carboxylic acid?
6-methyl-1,2,4-triazine-5-carboxylic acid has a molecular weight of 139.11 g/mol, XLogP of -0.12, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-1,2,4-triazine-5-carboxylic acid is sourced from PubChem (CID 83635324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).