C12H7Cl2N3 — CID 83738665
2-(2,4-dichlorophenyl)-2-pyrazin-2-ylacetonitrile (PubChem CID 83738665) has the molecular formula C12H7Cl2N3 and a molecular weight of 264.12 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-2-pyrazin-2-ylacetonitrile.
| Compound Name | 2-(2,4-dichlorophenyl)-2-pyrazin-2-ylacetonitrile |
|---|---|
| PubChem CID | 83738665 |
| Molecular Formula | C12H7Cl2N3 |
| Molecular Weight | 264.12 g/mol |
| Exact Mass | 263.00 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-2-pyrazin-2-ylacetonitrile |
| SMILES | N#CC(c1cnccn1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H7Cl2N3/c13-8-1-2-9(11(14)5-8)10(6-15)12-7-16-3-4-17-12/h1-5,7,10H |
| InChIKey | HFARCEWQHKSNFH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.12 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |