C14H6Cl3F3N2 — CID 56604864
2-[6-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-(2,4-dichlorophenyl)acetonitrile (PubChem CID 56604864) has the molecular formula C14H6Cl3F3N2 and a molecular weight of 365.57 g/mol. Its IUPAC name is 2-[6-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-(2,4-dichlorophenyl)acetonitrile.
| Compound Name | 2-[6-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-(2,4-dichlorophenyl)acetonitrile |
|---|---|
| PubChem CID | 56604864 |
| Molecular Formula | C14H6Cl3F3N2 |
| Molecular Weight | 365.57 g/mol |
| Exact Mass | 363.95 |
| IUPAC Name | 2-[6-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-(2,4-dichlorophenyl)acetonitrile |
| SMILES | N#CC(c1ccc(C(F)(F)F)c(Cl)n1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H6Cl3F3N2/c15-7-1-2-8(11(16)5-7)9(6-21)12-4-3-10(13(17)22-12)14(18,19)20/h1-5,9H |
| InChIKey | NRAYSKSAJKVBGQ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.57 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|