C16H9Cl2N3 — CID 5156996
2-cinnolin-4-yl-2-(2,4-dichlorophenyl)acetonitrile (PubChem CID 5156996) has the molecular formula C16H9Cl2N3 and a molecular weight of 314.18 g/mol. Its IUPAC name is 2-cinnolin-4-yl-2-(2,4-dichlorophenyl)acetonitrile.
| Compound Name | 2-cinnolin-4-yl-2-(2,4-dichlorophenyl)acetonitrile |
|---|---|
| PubChem CID | 5156996 |
| Molecular Formula | C16H9Cl2N3 |
| Molecular Weight | 314.18 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | 2-cinnolin-4-yl-2-(2,4-dichlorophenyl)acetonitrile |
| SMILES | N#CC(c1ccc(Cl)cc1Cl)c1cnnc2ccccc12 |
| InChI | InChI=1S/C16H9Cl2N3/c17-10-5-6-11(15(18)7-10)13(8-19)14-9-20-21-16-4-2-1-3-12(14)16/h1-7,9,13H |
| InChIKey | UOGZCJVLIVFLOZ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.18 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyano_misc_A(1)', 'substructure': 'N/A'} |
|---|