C18H14ClN3O2 — CID 69368661
2-(4-chlorophenyl)-2-(6,7-dimethoxycinnolin-4-yl)acetonitrile (PubChem CID 69368661) has the molecular formula C18H14ClN3O2 and a molecular weight of 339.78 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-(6,7-dimethoxycinnolin-4-yl)acetonitrile.
| Compound Name | 2-(4-chlorophenyl)-2-(6,7-dimethoxycinnolin-4-yl)acetonitrile |
|---|---|
| PubChem CID | 69368661 |
| Molecular Formula | C18H14ClN3O2 |
| Molecular Weight | 339.78 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 2-(4-chlorophenyl)-2-(6,7-dimethoxycinnolin-4-yl)acetonitrile |
| SMILES | COc1cc2nncc(C(C#N)c3ccc(Cl)cc3)c2cc1OC |
| InChI | InChI=1S/C18H14ClN3O2/c1-23-17-7-13-15(10-21-22-16(13)8-18(17)24-2)14(9-20)11-3-5-12(19)6-4-11/h3-8,10,14H,1-2H3 |
| InChIKey | WOEAUZNQSRAKPQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 68.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.78 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_misc_A(1)', 'substructure': 'N/A'} |
|---|