C15H14N4O2 — CID 57395734
5-(6,7-dimethoxycinnolin-4-yl)pyridin-2-amine (PubChem CID 57395734) has the molecular formula C15H14N4O2 and a molecular weight of 282.30 g/mol. Its IUPAC name is 5-(6,7-dimethoxycinnolin-4-yl)pyridin-2-amine.
| Compound Name | 5-(6,7-dimethoxycinnolin-4-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 57395734 |
| Molecular Formula | C15H14N4O2 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 5-(6,7-dimethoxycinnolin-4-yl)pyridin-2-amine |
| SMILES | COc1cc2nncc(-c3ccc(N)nc3)c2cc1OC |
| InChI | InChI=1S/C15H14N4O2/c1-20-13-5-10-11(9-3-4-15(16)17-7-9)8-18-19-12(10)6-14(13)21-2/h3-8H,1-2H3,(H2,16,17) |
| InChIKey | SAKMBAGLFFHZGR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 83.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |