C10H13NO2 — CID 83816824
1-methyl-4,5,6,7-tetrahydroindole-2-carboxylic acid (PubChem CID 83816824) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 1-methyl-4,5,6,7-tetrahydroindole-2-carboxylic acid.
| Compound Name | 1-methyl-4,5,6,7-tetrahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 83816824 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 1-methyl-4,5,6,7-tetrahydroindole-2-carboxylic acid |
| SMILES | Cn1c(C(=O)O)cc2c1CCCC2 |
| InChI | InChI=1S/C10H13NO2/c1-11-8-5-3-2-4-7(8)6-9(11)10(12)13/h6H,2-5H2,1H3,(H,12,13) |
| InChIKey | WZOZVVWFNMNTFL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |