C34H32N2O2 — CID 162402454
(E,4Z)-4-[(benzylamino)-(1-methyl-4,5,6,7-tetrahydroindol-2-yl)methylidene]-1,5-diphenylpent-2-ene-1,5-dione (PubChem CID 162402454) has the molecular formula C34H32N2O2 and a molecular weight of 500.64 g/mol. Its IUPAC name is (E,4Z)-4-[(benzylamino)-(1-methyl-4,5,6,7-tetrahydroindol-2-yl)methylidene]-1,5-diphenylpent-2-ene-1,5-dione.
| Compound Name | (E,4Z)-4-[(benzylamino)-(1-methyl-4,5,6,7-tetrahydroindol-2-yl)methylidene]-1,5-diphenylpent-2-ene-1,5-dione |
|---|---|
| PubChem CID | 162402454 |
| Molecular Formula | C34H32N2O2 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | (E,4Z)-4-[(benzylamino)-(1-methyl-4,5,6,7-tetrahydroindol-2-yl)methylidene]-1,5-diphenylpent-2-ene-1,5-dione |
| SMILES | Cn1c(/C(NCc2ccccc2)=C(\C=C\C(=O)c2ccccc2)C(=O)c2ccccc2)cc2c1CCCC2 |
| InChI | InChI=1S/C34H32N2O2/c1-36-30-20-12-11-19-28(30)23-31(36)33(35-24-25-13-5-2-6-14-25)29(34(38)27-17-9-4-10-18-27)21-22-32(37)26-15-7-3-8-16-26/h2-10,13-18,21-23,35H,11-12,19-20,24H2,1H3/b22-21+,33-29- |
| InChIKey | PXIPCPDQZVRIAS-MMDKYWJWSA-N |
| XLogP | 6.73 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|