About cyclopentylmethyl piperazine-1-carboxylate
cyclopentylmethyl piperazine-1-carboxylate (PubChem CID 83821151) has the molecular formula C11H20N2O2
and a molecular weight of 212.29 g/mol. Its IUPAC name is cyclopentylmethyl piperazine-1-carboxylate.
Molecular Properties
| Compound Name | cyclopentylmethyl piperazine-1-carboxylate |
| PubChem CID | 83821151 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | cyclopentylmethyl piperazine-1-carboxylate |
| SMILES | O=C(OCC1CCCC1)N1CCNCC1 |
| InChI | InChI=1S/C11H20N2O2/c14-11(13-7-5-12-6-8-13)15-9-10-3-1-2-4-10/h10,12H,1-9H2 |
| InChIKey | DMOMNGJQASHVBI-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclopentylmethyl piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentylmethyl piperazine-1-carboxylate?
The IUPAC name of cyclopentylmethyl piperazine-1-carboxylate (CID 83821151) is cyclopentylmethyl piperazine-1-carboxylate.
What is the SMILES notation for cyclopentylmethyl piperazine-1-carboxylate?
The canonical SMILES for cyclopentylmethyl piperazine-1-carboxylate is O=C(OCC1CCCC1)N1CCNCC1.
What is the InChIKey of cyclopentylmethyl piperazine-1-carboxylate?
The InChIKey is DMOMNGJQASHVBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O2/c14-11(13-7-5-12-6-8-13)15-9-10-3-1-2-4-10/h10,12H,1-9H2.
What are the key properties of cyclopentylmethyl piperazine-1-carboxylate?
cyclopentylmethyl piperazine-1-carboxylate has a molecular weight of 212.29 g/mol, XLogP of 1.22, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentylmethyl piperazine-1-carboxylate is sourced from PubChem (CID 83821151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).