2-methylimidazo[1,2-a]pyridine-8-sulfonyl chloride

C8H7ClN2O2S — CID 83823881

IUPAC2-methylimidazo[1,2-a]pyridine-8-sulfonyl chloride
SMILESCc1cn2cccc(S(=O)(=O)Cl)c2n1
InChIInChI=1S/C8H7ClN2O2S/c1-6-5-11-4-2-3-7(8(11)10-6)14(9,12)13/h2-5H,1H3
InChIKeyKNVKIRGCONYUMI-UHFFFAOYSA-N
MW230.68 g/mol
LogP1.57
Rot. Bonds1

About 2-methylimidazo[1,2-a]pyridine-8-sulfonyl chloride

2-methylimidazo[1,2-a]pyridine-8-sulfonyl chloride (PubChem CID 83823881) has the molecular formula C8H7ClN2O2S and a molecular weight of 230.68 g/mol. Its IUPAC name is 2-methylimidazo[1,2-a]pyridine-8-sulfonyl chloride.

Molecular Properties

Compound Name2-methylimidazo[1,2-a]pyridine-8-sulfonyl chloride
PubChem CID83823881
Molecular FormulaC8H7ClN2O2S
Molecular Weight230.68 g/mol
Exact Mass229.99
IUPAC Name2-methylimidazo[1,2-a]pyridine-8-sulfonyl chloride
SMILESCc1cn2cccc(S(=O)(=O)Cl)c2n1
InChIInChI=1S/C8H7ClN2O2S/c1-6-5-11-4-2-3-7(8(11)10-6)14(9,12)13/h2-5H,1H3
InChIKeyKNVKIRGCONYUMI-UHFFFAOYSA-N
XLogP1.57
TPSA51.44 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.68
LogP ≤ 51.57
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 2-methylimidazo[1,2-a]pyridine-8-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methylimidazo[1,2-a]pyridine-8-sulfonyl chloride?
The IUPAC name of 2-methylimidazo[1,2-a]pyridine-8-sulfonyl chloride (CID 83823881) is 2-methylimidazo[1,2-a]pyridine-8-sulfonyl chloride.
What is the SMILES notation for 2-methylimidazo[1,2-a]pyridine-8-sulfonyl chloride?
The canonical SMILES for 2-methylimidazo[1,2-a]pyridine-8-sulfonyl chloride is Cc1cn2cccc(S(=O)(=O)Cl)c2n1.
What is the InChIKey of 2-methylimidazo[1,2-a]pyridine-8-sulfonyl chloride?
The InChIKey is KNVKIRGCONYUMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClN2O2S/c1-6-5-11-4-2-3-7(8(11)10-6)14(9,12)13/h2-5H,1H3.
What are the key properties of 2-methylimidazo[1,2-a]pyridine-8-sulfonyl chloride?
2-methylimidazo[1,2-a]pyridine-8-sulfonyl chloride has a molecular weight of 230.68 g/mol, XLogP of 1.57, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylimidazo[1,2-a]pyridine-8-sulfonyl chloride is sourced from PubChem (CID 83823881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).