C8H7ClN2O2S — CID 83823881
2-methylimidazo[1,2-a]pyridine-8-sulfonyl chloride (PubChem CID 83823881) has the molecular formula C8H7ClN2O2S and a molecular weight of 230.68 g/mol. Its IUPAC name is 2-methylimidazo[1,2-a]pyridine-8-sulfonyl chloride.
| Compound Name | 2-methylimidazo[1,2-a]pyridine-8-sulfonyl chloride |
|---|---|
| PubChem CID | 83823881 |
| Molecular Formula | C8H7ClN2O2S |
| Molecular Weight | 230.68 g/mol |
| Exact Mass | 229.99 |
| IUPAC Name | 2-methylimidazo[1,2-a]pyridine-8-sulfonyl chloride |
| SMILES | Cc1cn2cccc(S(=O)(=O)Cl)c2n1 |
| InChI | InChI=1S/C8H7ClN2O2S/c1-6-5-11-4-2-3-7(8(11)10-6)14(9,12)13/h2-5H,1H3 |
| InChIKey | KNVKIRGCONYUMI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 51.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.68 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |