About 5-(oxan-4-ylamino)-2,3-dihydro-1H-inden-1-ol
5-(oxan-4-ylamino)-2,3-dihydro-1H-inden-1-ol (PubChem CID 83824135) has the molecular formula C14H19NO2
and a molecular weight of 233.31 g/mol. Its IUPAC name is 5-(oxan-4-ylamino)-2,3-dihydro-1H-inden-1-ol.
Molecular Properties
| Compound Name | 5-(oxan-4-ylamino)-2,3-dihydro-1H-inden-1-ol |
| PubChem CID | 83824135 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 5-(oxan-4-ylamino)-2,3-dihydro-1H-inden-1-ol |
| SMILES | OC1CCc2cc(NC3CCOCC3)ccc21 |
| InChI | InChI=1S/C14H19NO2/c16-14-4-1-10-9-12(2-3-13(10)14)15-11-5-7-17-8-6-11/h2-3,9,11,14-16H,1,4-8H2 |
| InChIKey | HGAALWIVPGUBGE-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(oxan-4-ylamino)-2,3-dihydro-1H-inden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(oxan-4-ylamino)-2,3-dihydro-1H-inden-1-ol?
The IUPAC name of 5-(oxan-4-ylamino)-2,3-dihydro-1H-inden-1-ol (CID 83824135) is 5-(oxan-4-ylamino)-2,3-dihydro-1H-inden-1-ol.
What is the SMILES notation for 5-(oxan-4-ylamino)-2,3-dihydro-1H-inden-1-ol?
The canonical SMILES for 5-(oxan-4-ylamino)-2,3-dihydro-1H-inden-1-ol is OC1CCc2cc(NC3CCOCC3)ccc21.
What is the InChIKey of 5-(oxan-4-ylamino)-2,3-dihydro-1H-inden-1-ol?
The InChIKey is HGAALWIVPGUBGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO2/c16-14-4-1-10-9-12(2-3-13(10)14)15-11-5-7-17-8-6-11/h2-3,9,11,14-16H,1,4-8H2.
What are the key properties of 5-(oxan-4-ylamino)-2,3-dihydro-1H-inden-1-ol?
5-(oxan-4-ylamino)-2,3-dihydro-1H-inden-1-ol has a molecular weight of 233.31 g/mol, XLogP of 2.26, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(oxan-4-ylamino)-2,3-dihydro-1H-inden-1-ol is sourced from PubChem (CID 83824135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).