C12H17N3 — CID 83832289
3-piperidin-4-yl-6,7-dihydro-5H-cyclopenta[b]pyrazine (PubChem CID 83832289) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is 3-piperidin-4-yl-6,7-dihydro-5H-cyclopenta[b]pyrazine.
| Compound Name | 3-piperidin-4-yl-6,7-dihydro-5H-cyclopenta[b]pyrazine |
|---|---|
| PubChem CID | 83832289 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 3-piperidin-4-yl-6,7-dihydro-5H-cyclopenta[b]pyrazine |
| SMILES | c1nc2c(nc1C1CCNCC1)CCC2 |
| InChI | InChI=1S/C12H17N3/c1-2-10-11(3-1)15-12(8-14-10)9-4-6-13-7-5-9/h8-9,13H,1-7H2 |
| InChIKey | SMBGOJSEINNUPL-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |