C11H16N4 — CID 105456701
5-cyclopropyl-3-piperidin-4-yl-1,2,4-triazine (PubChem CID 105456701) has the molecular formula C11H16N4 and a molecular weight of 204.28 g/mol. Its IUPAC name is 5-cyclopropyl-3-piperidin-4-yl-1,2,4-triazine.
| Compound Name | 5-cyclopropyl-3-piperidin-4-yl-1,2,4-triazine |
|---|---|
| PubChem CID | 105456701 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 5-cyclopropyl-3-piperidin-4-yl-1,2,4-triazine |
| SMILES | c1nnc(C2CCNCC2)nc1C1CC1 |
| InChI | InChI=1S/C11H16N4/c1-2-8(1)10-7-13-15-11(14-10)9-3-5-12-6-4-9/h7-9,12H,1-6H2 |
| InChIKey | GTDMQTBUOXYEQI-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |