About 2-[methyl([1,3]oxazolo[5,4-d]pyrimidin-5-yl)amino]acetic acid
2-[methyl([1,3]oxazolo[5,4-d]pyrimidin-5-yl)amino]acetic acid (PubChem CID 83834011) has the molecular formula C8H8N4O3
and a molecular weight of 208.18 g/mol. Its IUPAC name is 2-[methyl([1,3]oxazolo[5,4-d]pyrimidin-5-yl)amino]acetic acid.
Analyze 2-[methyl([1,3]oxazolo[5,4-d]pyrimidin-5-yl)amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[methyl([1,3]oxazolo[5,4-d]pyrimidin-5-yl)amino]acetic acid?
The IUPAC name of 2-[methyl([1,3]oxazolo[5,4-d]pyrimidin-5-yl)amino]acetic acid (CID 83834011) is 2-[methyl([1,3]oxazolo[5,4-d]pyrimidin-5-yl)amino]acetic acid.
What is the SMILES notation for 2-[methyl([1,3]oxazolo[5,4-d]pyrimidin-5-yl)amino]acetic acid?
The canonical SMILES for 2-[methyl([1,3]oxazolo[5,4-d]pyrimidin-5-yl)amino]acetic acid is CN(CC(=O)O)c1ncc2ncoc2n1.
What is the InChIKey of 2-[methyl([1,3]oxazolo[5,4-d]pyrimidin-5-yl)amino]acetic acid?
The InChIKey is NFHOXCBSTWVSMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4O3/c1-12(3-6(13)14)8-9-2-5-7(11-8)15-4-10-5/h2,4H,3H2,1H3,(H,13,14).
What are the key properties of 2-[methyl([1,3]oxazolo[5,4-d]pyrimidin-5-yl)amino]acetic acid?
2-[methyl([1,3]oxazolo[5,4-d]pyrimidin-5-yl)amino]acetic acid has a molecular weight of 208.18 g/mol, XLogP of 0.14, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[methyl([1,3]oxazolo[5,4-d]pyrimidin-5-yl)amino]acetic acid is sourced from PubChem (CID 83834011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).