2-(3-chloroimidazo[1,5-a]pyridin-8-yl)acetic acid

C9H7ClN2O2 — CID 83834903

IUPAC2-(3-chloroimidazo[1,5-a]pyridin-8-yl)acetic acid
SMILESO=C(O)Cc1cccn2c(Cl)ncc12
InChIInChI=1S/C9H7ClN2O2/c10-9-11-5-7-6(4-8(13)14)2-1-3-12(7)9/h1-3,5H,4H2,(H,13,14)
InChIKeyCVXARTOMAZPMKS-UHFFFAOYSA-N
MW210.62 g/mol
LogP1.61
Rot. Bonds2

About 2-(3-chloroimidazo[1,5-a]pyridin-8-yl)acetic acid

2-(3-chloroimidazo[1,5-a]pyridin-8-yl)acetic acid (PubChem CID 83834903) has the molecular formula C9H7ClN2O2 and a molecular weight of 210.62 g/mol. Its IUPAC name is 2-(3-chloroimidazo[1,5-a]pyridin-8-yl)acetic acid.

Molecular Properties

Compound Name2-(3-chloroimidazo[1,5-a]pyridin-8-yl)acetic acid
PubChem CID83834903
Molecular FormulaC9H7ClN2O2
Molecular Weight210.62 g/mol
Exact Mass210.02
IUPAC Name2-(3-chloroimidazo[1,5-a]pyridin-8-yl)acetic acid
SMILESO=C(O)Cc1cccn2c(Cl)ncc12
InChIInChI=1S/C9H7ClN2O2/c10-9-11-5-7-6(4-8(13)14)2-1-3-12(7)9/h1-3,5H,4H2,(H,13,14)
InChIKeyCVXARTOMAZPMKS-UHFFFAOYSA-N
XLogP1.61
TPSA54.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.62
LogP ≤ 51.61
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(3-chloroimidazo[1,5-a]pyridin-8-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3-chloroimidazo[1,5-a]pyridin-8-yl)acetic acid?
The IUPAC name of 2-(3-chloroimidazo[1,5-a]pyridin-8-yl)acetic acid (CID 83834903) is 2-(3-chloroimidazo[1,5-a]pyridin-8-yl)acetic acid.
What is the SMILES notation for 2-(3-chloroimidazo[1,5-a]pyridin-8-yl)acetic acid?
The canonical SMILES for 2-(3-chloroimidazo[1,5-a]pyridin-8-yl)acetic acid is O=C(O)Cc1cccn2c(Cl)ncc12.
What is the InChIKey of 2-(3-chloroimidazo[1,5-a]pyridin-8-yl)acetic acid?
The InChIKey is CVXARTOMAZPMKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClN2O2/c10-9-11-5-7-6(4-8(13)14)2-1-3-12(7)9/h1-3,5H,4H2,(H,13,14).
What are the key properties of 2-(3-chloroimidazo[1,5-a]pyridin-8-yl)acetic acid?
2-(3-chloroimidazo[1,5-a]pyridin-8-yl)acetic acid has a molecular weight of 210.62 g/mol, XLogP of 1.61, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chloroimidazo[1,5-a]pyridin-8-yl)acetic acid is sourced from PubChem (CID 83834903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).