C9H7FN2O2 — CID 83878677
2-(8-fluoroimidazo[1,5-a]pyridin-3-yl)acetic acid (PubChem CID 83878677) has the molecular formula C9H7FN2O2 and a molecular weight of 194.17 g/mol. Its IUPAC name is 2-(8-fluoroimidazo[1,5-a]pyridin-3-yl)acetic acid.
| Compound Name | 2-(8-fluoroimidazo[1,5-a]pyridin-3-yl)acetic acid |
|---|---|
| PubChem CID | 83878677 |
| Molecular Formula | C9H7FN2O2 |
| Molecular Weight | 194.17 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 2-(8-fluoroimidazo[1,5-a]pyridin-3-yl)acetic acid |
| SMILES | O=C(O)Cc1ncc2c(F)cccn12 |
| InChI | InChI=1S/C9H7FN2O2/c10-6-2-1-3-12-7(6)5-11-8(12)4-9(13)14/h1-3,5H,4H2,(H,13,14) |
| InChIKey | WUOSSZYTGVFJBB-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.17 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |