C9H6FN3O4 — CID 83898442
2-(8-fluoro-1-nitroimidazo[1,5-a]pyridin-3-yl)acetic acid (PubChem CID 83898442) has the molecular formula C9H6FN3O4 and a molecular weight of 239.16 g/mol. Its IUPAC name is 2-(8-fluoro-1-nitroimidazo[1,5-a]pyridin-3-yl)acetic acid.
| Compound Name | 2-(8-fluoro-1-nitroimidazo[1,5-a]pyridin-3-yl)acetic acid |
|---|---|
| PubChem CID | 83898442 |
| Molecular Formula | C9H6FN3O4 |
| Molecular Weight | 239.16 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 2-(8-fluoro-1-nitroimidazo[1,5-a]pyridin-3-yl)acetic acid |
| SMILES | O=C(O)Cc1nc([N+](=O)[O-])c2c(F)cccn12 |
| InChI | InChI=1S/C9H6FN3O4/c10-5-2-1-3-12-6(4-7(14)15)11-9(8(5)12)13(16)17/h1-3H,4H2,(H,14,15) |
| InChIKey | SWXGNODYEIBMHT-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.16 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|