C9H7N3O4 — CID 83889798
2-(1-nitroimidazo[1,5-a]pyridin-3-yl)acetic acid (PubChem CID 83889798) has the molecular formula C9H7N3O4 and a molecular weight of 221.17 g/mol. Its IUPAC name is 2-(1-nitroimidazo[1,5-a]pyridin-3-yl)acetic acid.
| Compound Name | 2-(1-nitroimidazo[1,5-a]pyridin-3-yl)acetic acid |
|---|---|
| PubChem CID | 83889798 |
| Molecular Formula | C9H7N3O4 |
| Molecular Weight | 221.17 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | 2-(1-nitroimidazo[1,5-a]pyridin-3-yl)acetic acid |
| SMILES | O=C(O)Cc1nc([N+](=O)[O-])c2ccccn12 |
| InChI | InChI=1S/C9H7N3O4/c13-8(14)5-7-10-9(12(15)16)6-3-1-2-4-11(6)7/h1-4H,5H2,(H,13,14) |
| InChIKey | VVWJJRMJWRLIAB-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.17 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|