C15H21N — CID 83835758
2-(2-methyl-2,3-dihydro-1H-inden-5-yl)piperidine (PubChem CID 83835758) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is 2-(2-methyl-2,3-dihydro-1H-inden-5-yl)piperidine.
| Compound Name | 2-(2-methyl-2,3-dihydro-1H-inden-5-yl)piperidine |
|---|---|
| PubChem CID | 83835758 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 2-(2-methyl-2,3-dihydro-1H-inden-5-yl)piperidine |
| SMILES | CC1Cc2ccc(C3CCCCN3)cc2C1 |
| InChI | InChI=1S/C15H21N/c1-11-8-12-5-6-13(10-14(12)9-11)15-4-2-3-7-16-15/h5-6,10-11,15-16H,2-4,7-9H2,1H3 |
| InChIKey | RWMQQZZIIWRDQQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |