C8H13N3O2 — CID 838369
4,6-dimethoxy-N,N-dimethylpyrimidin-2-amine (PubChem CID 838369) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is 4,6-dimethoxy-N,N-dimethylpyrimidin-2-amine.
| Compound Name | 4,6-dimethoxy-N,N-dimethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 838369 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 4,6-dimethoxy-N,N-dimethylpyrimidin-2-amine |
| SMILES | COc1cc(OC)nc(N(C)C)n1 |
| InChI | InChI=1S/C8H13N3O2/c1-11(2)8-9-6(12-3)5-7(10-8)13-4/h5H,1-4H3 |
| InChIKey | LQJYTNBYICJMDK-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |