About [1-([1,2]oxazolo[5,4-d]pyrimidin-4-yl)pyrrolidin-3-yl]methanamine
[1-([1,2]oxazolo[5,4-d]pyrimidin-4-yl)pyrrolidin-3-yl]methanamine (PubChem CID 83837076) has the molecular formula C10H13N5O
and a molecular weight of 219.25 g/mol. Its IUPAC name is [1-([1,2]oxazolo[5,4-d]pyrimidin-4-yl)pyrrolidin-3-yl]methanamine.
Molecular Properties
| Compound Name | [1-([1,2]oxazolo[5,4-d]pyrimidin-4-yl)pyrrolidin-3-yl]methanamine |
| PubChem CID | 83837076 |
| Molecular Formula | C10H13N5O |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | [1-([1,2]oxazolo[5,4-d]pyrimidin-4-yl)pyrrolidin-3-yl]methanamine |
| SMILES | NCC1CCN(c2ncnc3oncc23)C1 |
| InChI | InChI=1S/C10H13N5O/c11-3-7-1-2-15(5-7)9-8-4-14-16-10(8)13-6-12-9/h4,6-7H,1-3,5,11H2 |
| InChIKey | LBANBPKTDGPETF-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-([1,2]oxazolo[5,4-d]pyrimidin-4-yl)pyrrolidin-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-([1,2]oxazolo[5,4-d]pyrimidin-4-yl)pyrrolidin-3-yl]methanamine?
The IUPAC name of [1-([1,2]oxazolo[5,4-d]pyrimidin-4-yl)pyrrolidin-3-yl]methanamine (CID 83837076) is [1-([1,2]oxazolo[5,4-d]pyrimidin-4-yl)pyrrolidin-3-yl]methanamine.
What is the SMILES notation for [1-([1,2]oxazolo[5,4-d]pyrimidin-4-yl)pyrrolidin-3-yl]methanamine?
The canonical SMILES for [1-([1,2]oxazolo[5,4-d]pyrimidin-4-yl)pyrrolidin-3-yl]methanamine is NCC1CCN(c2ncnc3oncc23)C1.
What is the InChIKey of [1-([1,2]oxazolo[5,4-d]pyrimidin-4-yl)pyrrolidin-3-yl]methanamine?
The InChIKey is LBANBPKTDGPETF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N5O/c11-3-7-1-2-15(5-7)9-8-4-14-16-10(8)13-6-12-9/h4,6-7H,1-3,5,11H2.
What are the key properties of [1-([1,2]oxazolo[5,4-d]pyrimidin-4-yl)pyrrolidin-3-yl]methanamine?
[1-([1,2]oxazolo[5,4-d]pyrimidin-4-yl)pyrrolidin-3-yl]methanamine has a molecular weight of 219.25 g/mol, XLogP of 0.40, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-([1,2]oxazolo[5,4-d]pyrimidin-4-yl)pyrrolidin-3-yl]methanamine is sourced from PubChem (CID 83837076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).