C12H12N2O3 — CID 83840831
1-cyclopropyl-3-oxo-2,4-dihydroquinoxaline-5-carboxylic acid (PubChem CID 83840831) has the molecular formula C12H12N2O3 and a molecular weight of 232.24 g/mol. Its IUPAC name is 1-cyclopropyl-3-oxo-2,4-dihydroquinoxaline-5-carboxylic acid.
| Compound Name | 1-cyclopropyl-3-oxo-2,4-dihydroquinoxaline-5-carboxylic acid |
|---|---|
| PubChem CID | 83840831 |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 1-cyclopropyl-3-oxo-2,4-dihydroquinoxaline-5-carboxylic acid |
| SMILES | O=C1CN(C2CC2)c2cccc(C(=O)O)c2N1 |
| InChI | InChI=1S/C12H12N2O3/c15-10-6-14(7-4-5-7)9-3-1-2-8(12(16)17)11(9)13-10/h1-3,7H,4-6H2,(H,13,15)(H,16,17) |
| InChIKey | WDFYTONJDQGZQT-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |