About 7-bromo-3-cyclopropyl-5-methyltriazolo[4,5-b]pyridine
7-bromo-3-cyclopropyl-5-methyltriazolo[4,5-b]pyridine (PubChem CID 83843857) has the molecular formula C9H9BrN4
and a molecular weight of 253.10 g/mol. Its IUPAC name is 7-bromo-3-cyclopropyl-5-methyltriazolo[4,5-b]pyridine.
Analyze 7-bromo-3-cyclopropyl-5-methyltriazolo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-3-cyclopropyl-5-methyltriazolo[4,5-b]pyridine?
The IUPAC name of 7-bromo-3-cyclopropyl-5-methyltriazolo[4,5-b]pyridine (CID 83843857) is 7-bromo-3-cyclopropyl-5-methyltriazolo[4,5-b]pyridine.
What is the SMILES notation for 7-bromo-3-cyclopropyl-5-methyltriazolo[4,5-b]pyridine?
The canonical SMILES for 7-bromo-3-cyclopropyl-5-methyltriazolo[4,5-b]pyridine is Cc1cc(Br)c2nnn(C3CC3)c2n1.
What is the InChIKey of 7-bromo-3-cyclopropyl-5-methyltriazolo[4,5-b]pyridine?
The InChIKey is GHHFGGUDCRROFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrN4/c1-5-4-7(10)8-9(11-5)14(13-12-8)6-2-3-6/h4,6H,2-3H2,1H3.
What are the key properties of 7-bromo-3-cyclopropyl-5-methyltriazolo[4,5-b]pyridine?
7-bromo-3-cyclopropyl-5-methyltriazolo[4,5-b]pyridine has a molecular weight of 253.10 g/mol, XLogP of 2.23, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-3-cyclopropyl-5-methyltriazolo[4,5-b]pyridine is sourced from PubChem (CID 83843857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).