About 2-(7-methoxy-4-methyl-2,3-dihydro-1H-indol-2-yl)propanoic acid
2-(7-methoxy-4-methyl-2,3-dihydro-1H-indol-2-yl)propanoic acid (PubChem CID 83860546) has the molecular formula C13H17NO3
and a molecular weight of 235.28 g/mol. Its IUPAC name is 2-(7-methoxy-4-methyl-2,3-dihydro-1H-indol-2-yl)propanoic acid.
Analyze 2-(7-methoxy-4-methyl-2,3-dihydro-1H-indol-2-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-methoxy-4-methyl-2,3-dihydro-1H-indol-2-yl)propanoic acid?
The IUPAC name of 2-(7-methoxy-4-methyl-2,3-dihydro-1H-indol-2-yl)propanoic acid (CID 83860546) is 2-(7-methoxy-4-methyl-2,3-dihydro-1H-indol-2-yl)propanoic acid.
What is the SMILES notation for 2-(7-methoxy-4-methyl-2,3-dihydro-1H-indol-2-yl)propanoic acid?
The canonical SMILES for 2-(7-methoxy-4-methyl-2,3-dihydro-1H-indol-2-yl)propanoic acid is COc1ccc(C)c2c1NC(C(C)C(=O)O)C2.
What is the InChIKey of 2-(7-methoxy-4-methyl-2,3-dihydro-1H-indol-2-yl)propanoic acid?
The InChIKey is JYHJHLFSNOVOCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO3/c1-7-4-5-11(17-3)12-9(7)6-10(14-12)8(2)13(15)16/h4-5,8,10,14H,6H2,1-3H3,(H,15,16).
What are the key properties of 2-(7-methoxy-4-methyl-2,3-dihydro-1H-indol-2-yl)propanoic acid?
2-(7-methoxy-4-methyl-2,3-dihydro-1H-indol-2-yl)propanoic acid has a molecular weight of 235.28 g/mol, XLogP of 2.06, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-methoxy-4-methyl-2,3-dihydro-1H-indol-2-yl)propanoic acid is sourced from PubChem (CID 83860546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).