1-propan-2-yl-4,5,6,7-tetrahydroindazole-4-carboxylic acid

C11H16N2O2 — CID 83861850

IUPAC1-propan-2-yl-4,5,6,7-tetrahydroindazole-4-carboxylic acid
SMILESCC(C)n1ncc2c1CCCC2C(=O)O
InChIInChI=1S/C11H16N2O2/c1-7(2)13-10-5-3-4-8(11(14)15)9(10)6-12-13/h6-8H,3-5H2,1-2H3,(H,14,15)
InChIKeyZIJHPRKUWRMVHX-UHFFFAOYSA-N
MW208.26 g/mol
LogP1.97
Rot. Bonds2

About 1-propan-2-yl-4,5,6,7-tetrahydroindazole-4-carboxylic acid

1-propan-2-yl-4,5,6,7-tetrahydroindazole-4-carboxylic acid (PubChem CID 83861850) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 1-propan-2-yl-4,5,6,7-tetrahydroindazole-4-carboxylic acid.

Molecular Properties

Compound Name1-propan-2-yl-4,5,6,7-tetrahydroindazole-4-carboxylic acid
PubChem CID83861850
Molecular FormulaC11H16N2O2
Molecular Weight208.26 g/mol
Exact Mass208.12
IUPAC Name1-propan-2-yl-4,5,6,7-tetrahydroindazole-4-carboxylic acid
SMILESCC(C)n1ncc2c1CCCC2C(=O)O
InChIInChI=1S/C11H16N2O2/c1-7(2)13-10-5-3-4-8(11(14)15)9(10)6-12-13/h6-8H,3-5H2,1-2H3,(H,14,15)
InChIKeyZIJHPRKUWRMVHX-UHFFFAOYSA-N
XLogP1.97
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.26
LogP ≤ 51.97
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 1-propan-2-yl-4,5,6,7-tetrahydroindazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-propan-2-yl-4,5,6,7-tetrahydroindazole-4-carboxylic acid?
The IUPAC name of 1-propan-2-yl-4,5,6,7-tetrahydroindazole-4-carboxylic acid (CID 83861850) is 1-propan-2-yl-4,5,6,7-tetrahydroindazole-4-carboxylic acid.
What is the SMILES notation for 1-propan-2-yl-4,5,6,7-tetrahydroindazole-4-carboxylic acid?
The canonical SMILES for 1-propan-2-yl-4,5,6,7-tetrahydroindazole-4-carboxylic acid is CC(C)n1ncc2c1CCCC2C(=O)O.
What is the InChIKey of 1-propan-2-yl-4,5,6,7-tetrahydroindazole-4-carboxylic acid?
The InChIKey is ZIJHPRKUWRMVHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O2/c1-7(2)13-10-5-3-4-8(11(14)15)9(10)6-12-13/h6-8H,3-5H2,1-2H3,(H,14,15).
What are the key properties of 1-propan-2-yl-4,5,6,7-tetrahydroindazole-4-carboxylic acid?
1-propan-2-yl-4,5,6,7-tetrahydroindazole-4-carboxylic acid has a molecular weight of 208.26 g/mol, XLogP of 1.97, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-yl-4,5,6,7-tetrahydroindazole-4-carboxylic acid is sourced from PubChem (CID 83861850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).