C8H11F3N4 — CID 83866488
[3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-5-yl]methanamine (PubChem CID 83866488) has the molecular formula C8H11F3N4 and a molecular weight of 220.20 g/mol. Its IUPAC name is [3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-5-yl]methanamine.
| Compound Name | [3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-5-yl]methanamine |
|---|---|
| PubChem CID | 83866488 |
| Molecular Formula | C8H11F3N4 |
| Molecular Weight | 220.20 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | [3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-5-yl]methanamine |
| SMILES | NCC1CCCc2nnc(C(F)(F)F)n21 |
| InChI | InChI=1S/C8H11F3N4/c9-8(10,11)7-14-13-6-3-1-2-5(4-12)15(6)7/h5H,1-4,12H2 |
| InChIKey | OPZRIRBOSYYKKP-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.20 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |