C8H8ClN3 — CID 83869206
(1-chloroimidazo[1,5-a]pyridin-7-yl)methanamine (PubChem CID 83869206) has the molecular formula C8H8ClN3 and a molecular weight of 181.63 g/mol. Its IUPAC name is (1-chloroimidazo[1,5-a]pyridin-7-yl)methanamine.
| Compound Name | (1-chloroimidazo[1,5-a]pyridin-7-yl)methanamine |
|---|---|
| PubChem CID | 83869206 |
| Molecular Formula | C8H8ClN3 |
| Molecular Weight | 181.63 g/mol |
| Exact Mass | 181.04 |
| IUPAC Name | (1-chloroimidazo[1,5-a]pyridin-7-yl)methanamine |
| SMILES | NCc1ccn2cnc(Cl)c2c1 |
| InChI | InChI=1S/C8H8ClN3/c9-8-7-3-6(4-10)1-2-12(7)5-11-8/h1-3,5H,4,10H2 |
| InChIKey | DIUAIGZLDJQBQC-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.63 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |