C10H12ClN3 — CID 83869217
(1-chloro-3-ethylimidazo[1,5-a]pyridin-7-yl)methanamine (PubChem CID 83869217) has the molecular formula C10H12ClN3 and a molecular weight of 209.68 g/mol. Its IUPAC name is (1-chloro-3-ethylimidazo[1,5-a]pyridin-7-yl)methanamine.
| Compound Name | (1-chloro-3-ethylimidazo[1,5-a]pyridin-7-yl)methanamine |
|---|---|
| PubChem CID | 83869217 |
| Molecular Formula | C10H12ClN3 |
| Molecular Weight | 209.68 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | (1-chloro-3-ethylimidazo[1,5-a]pyridin-7-yl)methanamine |
| SMILES | CCc1nc(Cl)c2cc(CN)ccn12 |
| InChI | InChI=1S/C10H12ClN3/c1-2-9-13-10(11)8-5-7(6-12)3-4-14(8)9/h3-5H,2,6,12H2,1H3 |
| InChIKey | QDVBSSXMJJMQHD-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.68 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |