C11H14ClN3 — CID 83869485
1-(5-chloro-3-ethylimidazo[1,5-a]pyridin-1-yl)-N-methylmethanamine (PubChem CID 83869485) has the molecular formula C11H14ClN3 and a molecular weight of 223.71 g/mol. Its IUPAC name is 1-(5-chloro-3-ethylimidazo[1,5-a]pyridin-1-yl)-N-methylmethanamine.
| Compound Name | 1-(5-chloro-3-ethylimidazo[1,5-a]pyridin-1-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 83869485 |
| Molecular Formula | C11H14ClN3 |
| Molecular Weight | 223.71 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | 1-(5-chloro-3-ethylimidazo[1,5-a]pyridin-1-yl)-N-methylmethanamine |
| SMILES | CCc1nc(CNC)c2cccc(Cl)n12 |
| InChI | InChI=1S/C11H14ClN3/c1-3-11-14-8(7-13-2)9-5-4-6-10(12)15(9)11/h4-6,13H,3,7H2,1-2H3 |
| InChIKey | HSSHHDCIELRYPL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.71 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|