About 7-amino-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one
7-amino-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one (PubChem CID 83873339) has the molecular formula C8H11N3O
and a molecular weight of 165.20 g/mol. Its IUPAC name is 7-amino-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one.
Analyze 7-amino-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one?
The IUPAC name of 7-amino-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one (CID 83873339) is 7-amino-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one.
What is the SMILES notation for 7-amino-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one?
The canonical SMILES for 7-amino-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one is NC1CCc2nccc(=O)n2C1.
What is the InChIKey of 7-amino-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one?
The InChIKey is VMJQXXBKYMAYLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O/c9-6-1-2-7-10-4-3-8(12)11(7)5-6/h3-4,6H,1-2,5,9H2.
What are the key properties of 7-amino-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one?
7-amino-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one has a molecular weight of 165.20 g/mol, XLogP of -0.48, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one is sourced from PubChem (CID 83873339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).