About 2-imidazo[1,2-b][1,2,4]triazin-6-yl-N-methylethanamine
2-imidazo[1,2-b][1,2,4]triazin-6-yl-N-methylethanamine (PubChem CID 83874706) has the molecular formula C8H11N5
and a molecular weight of 177.21 g/mol. Its IUPAC name is 2-imidazo[1,2-b][1,2,4]triazin-6-yl-N-methylethanamine.
Analyze 2-imidazo[1,2-b][1,2,4]triazin-6-yl-N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imidazo[1,2-b][1,2,4]triazin-6-yl-N-methylethanamine?
The IUPAC name of 2-imidazo[1,2-b][1,2,4]triazin-6-yl-N-methylethanamine (CID 83874706) is 2-imidazo[1,2-b][1,2,4]triazin-6-yl-N-methylethanamine.
What is the SMILES notation for 2-imidazo[1,2-b][1,2,4]triazin-6-yl-N-methylethanamine?
The canonical SMILES for 2-imidazo[1,2-b][1,2,4]triazin-6-yl-N-methylethanamine is CNCCc1cn2nccnc2n1.
What is the InChIKey of 2-imidazo[1,2-b][1,2,4]triazin-6-yl-N-methylethanamine?
The InChIKey is UAOIOULGQCOYOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N5/c1-9-3-2-7-6-13-8(12-7)10-4-5-11-13/h4-6,9H,2-3H2,1H3.
What are the key properties of 2-imidazo[1,2-b][1,2,4]triazin-6-yl-N-methylethanamine?
2-imidazo[1,2-b][1,2,4]triazin-6-yl-N-methylethanamine has a molecular weight of 177.21 g/mol, XLogP of -0.11, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imidazo[1,2-b][1,2,4]triazin-6-yl-N-methylethanamine is sourced from PubChem (CID 83874706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).