C8H8N4O2 — CID 83877918
N-methyl-1-nitroimidazo[1,5-a]pyridin-8-amine (PubChem CID 83877918) has the molecular formula C8H8N4O2 and a molecular weight of 192.18 g/mol. Its IUPAC name is N-methyl-1-nitroimidazo[1,5-a]pyridin-8-amine.
| Compound Name | N-methyl-1-nitroimidazo[1,5-a]pyridin-8-amine |
|---|---|
| PubChem CID | 83877918 |
| Molecular Formula | C8H8N4O2 |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | N-methyl-1-nitroimidazo[1,5-a]pyridin-8-amine |
| SMILES | CNc1cccn2cnc([N+](=O)[O-])c12 |
| InChI | InChI=1S/C8H8N4O2/c1-9-6-3-2-4-11-5-10-8(7(6)11)12(13)14/h2-5,9H,1H3 |
| InChIKey | BLRWHLSUMRWYFR-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|