C7H8N4OS — CID 83879846
N'-hydroxy-2-imidazo[2,1-b][1,3]thiazol-2-ylethanimidamide (PubChem CID 83879846) has the molecular formula C7H8N4OS and a molecular weight of 196.24 g/mol. Its IUPAC name is N'-hydroxy-2-imidazo[2,1-b][1,3]thiazol-2-ylethanimidamide.
| Compound Name | N'-hydroxy-2-imidazo[2,1-b][1,3]thiazol-2-ylethanimidamide |
|---|---|
| PubChem CID | 83879846 |
| Molecular Formula | C7H8N4OS |
| Molecular Weight | 196.24 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | N'-hydroxy-2-imidazo[2,1-b][1,3]thiazol-2-ylethanimidamide |
| SMILES | N/C(Cc1cn2ccnc2s1)=N\O |
| InChI | InChI=1S/C7H8N4OS/c8-6(10-12)3-5-4-11-2-1-9-7(11)13-5/h1-2,4,12H,3H2,(H2,8,10) |
| InChIKey | MYMGFMUUWVBFPX-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 75.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.24 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|