3-imidazo[2,1-b][1,3]thiazol-2-ylpropanoic acid

C8H8N2O2S — CID 82399636

IUPAC3-imidazo[2,1-b][1,3]thiazol-2-ylpropanoic acid
SMILESO=C(O)CCc1cn2ccnc2s1
InChIInChI=1S/C8H8N2O2S/c11-7(12)2-1-6-5-10-4-3-9-8(10)13-6/h3-5H,1-2H2,(H,11,12)
InChIKeyHACQNHGKASBVML-UHFFFAOYSA-N
MW196.23 g/mol
LogP1.41
Rot. Bonds3

About 3-imidazo[2,1-b][1,3]thiazol-2-ylpropanoic acid

3-imidazo[2,1-b][1,3]thiazol-2-ylpropanoic acid (PubChem CID 82399636) has the molecular formula C8H8N2O2S and a molecular weight of 196.23 g/mol. Its IUPAC name is 3-imidazo[2,1-b][1,3]thiazol-2-ylpropanoic acid.

Molecular Properties

Compound Name3-imidazo[2,1-b][1,3]thiazol-2-ylpropanoic acid
PubChem CID82399636
Molecular FormulaC8H8N2O2S
Molecular Weight196.23 g/mol
Exact Mass196.03
IUPAC Name3-imidazo[2,1-b][1,3]thiazol-2-ylpropanoic acid
SMILESO=C(O)CCc1cn2ccnc2s1
InChIInChI=1S/C8H8N2O2S/c11-7(12)2-1-6-5-10-4-3-9-8(10)13-6/h3-5H,1-2H2,(H,11,12)
InChIKeyHACQNHGKASBVML-UHFFFAOYSA-N
XLogP1.41
TPSA54.60 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.23
LogP ≤ 51.41
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-imidazo[2,1-b][1,3]thiazol-2-ylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-imidazo[2,1-b][1,3]thiazol-2-ylpropanoic acid?
The IUPAC name of 3-imidazo[2,1-b][1,3]thiazol-2-ylpropanoic acid (CID 82399636) is 3-imidazo[2,1-b][1,3]thiazol-2-ylpropanoic acid.
What is the SMILES notation for 3-imidazo[2,1-b][1,3]thiazol-2-ylpropanoic acid?
The canonical SMILES for 3-imidazo[2,1-b][1,3]thiazol-2-ylpropanoic acid is O=C(O)CCc1cn2ccnc2s1.
What is the InChIKey of 3-imidazo[2,1-b][1,3]thiazol-2-ylpropanoic acid?
The InChIKey is HACQNHGKASBVML-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O2S/c11-7(12)2-1-6-5-10-4-3-9-8(10)13-6/h3-5H,1-2H2,(H,11,12).
What are the key properties of 3-imidazo[2,1-b][1,3]thiazol-2-ylpropanoic acid?
3-imidazo[2,1-b][1,3]thiazol-2-ylpropanoic acid has a molecular weight of 196.23 g/mol, XLogP of 1.41, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-imidazo[2,1-b][1,3]thiazol-2-ylpropanoic acid is sourced from PubChem (CID 82399636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).