C11H15NO3 — CID 83884323
2-amino-2-(6-methyl-4H-1,3-benzodioxin-8-yl)ethanol (PubChem CID 83884323) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is 2-amino-2-(6-methyl-4H-1,3-benzodioxin-8-yl)ethanol.
| Compound Name | 2-amino-2-(6-methyl-4H-1,3-benzodioxin-8-yl)ethanol |
|---|---|
| PubChem CID | 83884323 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 2-amino-2-(6-methyl-4H-1,3-benzodioxin-8-yl)ethanol |
| SMILES | Cc1cc2c(c(C(N)CO)c1)OCOC2 |
| InChI | InChI=1S/C11H15NO3/c1-7-2-8-5-14-6-15-11(8)9(3-7)10(12)4-13/h2-3,10,13H,4-6,12H2,1H3 |
| InChIKey | DEKODIGXYXYWBM-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |